C14H20F3NO2 — CID 142994928
(3E,5Z)-3-ethenyl-1-methoxy-N-[2,2,2-trifluoro-1-(oxiran-2-yl)ethyl]hepta-3,5-dien-2-amine (PubChem CID 142994928) has the molecular formula C14H20F3NO2 and a molecular weight of 291.31 g/mol. Its IUPAC name is (3E,5Z)-3-ethenyl-1-methoxy-N-[2,2,2-trifluoro-1-(oxiran-2-yl)ethyl]hepta-3,5-dien-2-amine.
| Compound Name | (3E,5Z)-3-ethenyl-1-methoxy-N-[2,2,2-trifluoro-1-(oxiran-2-yl)ethyl]hepta-3,5-dien-2-amine |
|---|---|
| PubChem CID | 142994928 |
| Molecular Formula | C14H20F3NO2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (3E,5Z)-3-ethenyl-1-methoxy-N-[2,2,2-trifluoro-1-(oxiran-2-yl)ethyl]hepta-3,5-dien-2-amine |
| SMILES | C=C/C(=C\C=C/C)C(COC)NC(C1CO1)C(F)(F)F |
| InChI | InChI=1S/C14H20F3NO2/c1-4-6-7-10(5-2)11(8-19-3)18-13(12-9-20-12)14(15,16)17/h4-7,11-13,18H,2,8-9H2,1,3H3/b6-4-,10-7+ |
| InChIKey | TZGLJJZEZYBJTD-BSAFSDHNSA-N |
| XLogP | 2.61 |
| TPSA | 33.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|