C14H24N2O — CID 91378889
4-ethenyl-3-morpholin-4-ylocta-4,6-dien-1-amine (PubChem CID 91378889) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 4-ethenyl-3-morpholin-4-ylocta-4,6-dien-1-amine.
| Compound Name | 4-ethenyl-3-morpholin-4-ylocta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 91378889 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 4-ethenyl-3-morpholin-4-ylocta-4,6-dien-1-amine |
| SMILES | C=CC(=CC=CC)C(CCN)N1CCOCC1 |
| InChI | InChI=1S/C14H24N2O/c1-3-5-6-13(4-2)14(7-8-15)16-9-11-17-12-10-16/h3-6,14H,2,7-12,15H2,1H3 |
| InChIKey | UHYNBYWLGPCOEB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|