C7H10N2O — CID 144546085
1-methyl-4,5-dimethylidene-1,3-diazinan-2-one (PubChem CID 144546085) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is 1-methyl-4,5-dimethylidene-1,3-diazinan-2-one.
| Compound Name | 1-methyl-4,5-dimethylidene-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 144546085 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 1-methyl-4,5-dimethylidene-1,3-diazinan-2-one |
| SMILES | C=C1CN(C)C(=O)NC1=C |
| InChI | InChI=1S/C7H10N2O/c1-5-4-9(3)7(10)8-6(5)2/h1-2,4H2,3H3,(H,8,10) |
| InChIKey | XBXXQRUDNXUZTR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |