C12H12O3 — CID 164702069
2,4,6-tris(ethenyl)benzene-1,3,5-triol (PubChem CID 164702069) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is 2,4,6-tris(ethenyl)benzene-1,3,5-triol.
| Compound Name | 2,4,6-tris(ethenyl)benzene-1,3,5-triol |
|---|---|
| PubChem CID | 164702069 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 2,4,6-tris(ethenyl)benzene-1,3,5-triol |
| SMILES | C=Cc1c(O)c(C=C)c(O)c(C=C)c1O |
| InChI | InChI=1S/C12H12O3/c1-4-7-10(13)8(5-2)12(15)9(6-3)11(7)14/h4-6,13-15H,1-3H2 |
| InChIKey | IQYGYYBHUBKQOG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |