C14H14O3 — CID 170047345
methyl 3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-5-hydroxybenzoate (PubChem CID 170047345) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is methyl 3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-5-hydroxybenzoate.
| Compound Name | methyl 3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-5-hydroxybenzoate |
|---|---|
| PubChem CID | 170047345 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | methyl 3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-5-hydroxybenzoate |
| SMILES | C=C/C=C\c1cc(C(=O)OC)cc(O)c1C=C |
| InChI | InChI=1S/C14H14O3/c1-4-6-7-10-8-11(14(16)17-3)9-13(15)12(10)5-2/h4-9,15H,1-2H2,3H3/b7-6- |
| InChIKey | RYIKUSZMNDXKNX-SREVYHEPSA-N |
| XLogP | 3.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|