C15H27N — CID 178090956
ethane;2-ethenyl-4-ethyl-3-[(Z)-prop-1-enyl]-1H-pyrrole (PubChem CID 178090956) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is ethane;2-ethenyl-4-ethyl-3-[(Z)-prop-1-enyl]-1H-pyrrole.
| Compound Name | ethane;2-ethenyl-4-ethyl-3-[(Z)-prop-1-enyl]-1H-pyrrole |
|---|---|
| PubChem CID | 178090956 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | ethane;2-ethenyl-4-ethyl-3-[(Z)-prop-1-enyl]-1H-pyrrole |
| SMILES | C=Cc1[nH]cc(CC)c1/C=C\C.CC.CC |
| InChI | InChI=1S/C11H15N.2C2H6/c1-4-7-10-9(5-2)8-12-11(10)6-3;2*1-2/h4,6-8,12H,3,5H2,1-2H3;2*1-2H3/b7-4-;; |
| InChIKey | VNYZTNCEMVFNLF-XIFWRFGDSA-N |
| XLogP | 5.31 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |