C12H16N2 — CID 144715193
4-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]but-1-en-2-amine (PubChem CID 144715193) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 4-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]but-1-en-2-amine.
| Compound Name | 4-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]but-1-en-2-amine |
|---|---|
| PubChem CID | 144715193 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 4-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]but-1-en-2-amine |
| SMILES | C=Cc1[nH]cc(CCC(=C)N)c1C=C |
| InChI | InChI=1S/C12H16N2/c1-4-11-10(7-6-9(3)13)8-14-12(11)5-2/h4-5,8,14H,1-3,6-7,13H2 |
| InChIKey | ZEFPEIUJZWHQKA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |