C16H33N — CID 177324812
ethane;2-ethenyl-3,4-diethyl-1H-pyrrole (PubChem CID 177324812) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is ethane;2-ethenyl-3,4-diethyl-1H-pyrrole.
| Compound Name | ethane;2-ethenyl-3,4-diethyl-1H-pyrrole |
|---|---|
| PubChem CID | 177324812 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | ethane;2-ethenyl-3,4-diethyl-1H-pyrrole |
| SMILES | C=Cc1[nH]cc(CC)c1CC.CC.CC.CC |
| InChI | InChI=1S/C10H15N.3C2H6/c1-4-8-7-11-10(6-3)9(8)5-2;3*1-2/h6-7,11H,3-5H2,1-2H3;3*1-2H3 |
| InChIKey | BPIAHTYWSRHDIU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |