C10H13N — CID 142984451
2,3-bis(ethenyl)-4-ethyl-1H-pyrrole (PubChem CID 142984451) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4-ethyl-1H-pyrrole.
| Compound Name | 2,3-bis(ethenyl)-4-ethyl-1H-pyrrole |
|---|---|
| PubChem CID | 142984451 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 2,3-bis(ethenyl)-4-ethyl-1H-pyrrole |
| SMILES | C=Cc1[nH]cc(CC)c1C=C |
| InChI | InChI=1S/C10H13N/c1-4-8-7-11-10(6-3)9(8)5-2/h5-7,11H,2-4H2,1H3 |
| InChIKey | FXCBCSMUOQGXTF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |