C11H17N — CID 142006410
2,3-bis(ethenyl)-4-methyl-1H-pyrrole;ethane (PubChem CID 142006410) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4-methyl-1H-pyrrole;ethane.
| Compound Name | 2,3-bis(ethenyl)-4-methyl-1H-pyrrole;ethane |
|---|---|
| PubChem CID | 142006410 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 2,3-bis(ethenyl)-4-methyl-1H-pyrrole;ethane |
| SMILES | C=Cc1[nH]cc(C)c1C=C.CC |
| InChI | InChI=1S/C9H11N.C2H6/c1-4-8-7(3)6-10-9(8)5-2;1-2/h4-6,10H,1-2H2,3H3;1-2H3 |
| InChIKey | VTPIANILEVZHNE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |