C10H11NO2 — CID 142923204
2,3-bis(ethenyl)-5-(hydroxymethyl)-1H-pyridin-4-one (PubChem CID 142923204) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-5-(hydroxymethyl)-1H-pyridin-4-one.
| Compound Name | 2,3-bis(ethenyl)-5-(hydroxymethyl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 142923204 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 2,3-bis(ethenyl)-5-(hydroxymethyl)-1H-pyridin-4-one |
| SMILES | C=Cc1[nH]cc(CO)c(=O)c1C=C |
| InChI | InChI=1S/C10H11NO2/c1-3-8-9(4-2)11-5-7(6-12)10(8)13/h3-5,12H,1-2,6H2,(H,11,13) |
| InChIKey | GXIGOXRDCYFKLP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |