About [2,3-bis(ethenyl)-5-sulfanylphenyl]methanol
[2,3-bis(ethenyl)-5-sulfanylphenyl]methanol (PubChem CID 145118793) has the molecular formula C11H12OS
and a molecular weight of 192.28 g/mol. Its IUPAC name is [2,3-bis(ethenyl)-5-sulfanylphenyl]methanol.
Molecular Properties
| Compound Name | [2,3-bis(ethenyl)-5-sulfanylphenyl]methanol |
| PubChem CID | 145118793 |
| Molecular Formula | C11H12OS |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | [2,3-bis(ethenyl)-5-sulfanylphenyl]methanol |
| SMILES | C=Cc1cc(S)cc(CO)c1C=C |
| InChI | InChI=1S/C11H12OS/c1-3-8-5-10(13)6-9(7-12)11(8)4-2/h3-6,12-13H,1-2,7H2 |
| InChIKey | BBSIETYXLDRNNT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [2,3-bis(ethenyl)-5-sulfanylphenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-bis(ethenyl)-5-sulfanylphenyl]methanol?
The IUPAC name of [2,3-bis(ethenyl)-5-sulfanylphenyl]methanol (CID 145118793) is [2,3-bis(ethenyl)-5-sulfanylphenyl]methanol.
What is the SMILES notation for [2,3-bis(ethenyl)-5-sulfanylphenyl]methanol?
The canonical SMILES for [2,3-bis(ethenyl)-5-sulfanylphenyl]methanol is C=Cc1cc(S)cc(CO)c1C=C.
What is the InChIKey of [2,3-bis(ethenyl)-5-sulfanylphenyl]methanol?
The InChIKey is BBSIETYXLDRNNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12OS/c1-3-8-5-10(13)6-9(7-12)11(8)4-2/h3-6,12-13H,1-2,7H2.
What are the key properties of [2,3-bis(ethenyl)-5-sulfanylphenyl]methanol?
[2,3-bis(ethenyl)-5-sulfanylphenyl]methanol has a molecular weight of 192.28 g/mol, XLogP of 2.75, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-bis(ethenyl)-5-sulfanylphenyl]methanol is sourced from PubChem (CID 145118793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).