C11H14O3 — CID 121218143
(2-ethenyl-4,5-dimethoxyphenyl)methanol (PubChem CID 121218143) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (2-ethenyl-4,5-dimethoxyphenyl)methanol.
| Compound Name | (2-ethenyl-4,5-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 121218143 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (2-ethenyl-4,5-dimethoxyphenyl)methanol |
| SMILES | C=Cc1cc(OC)c(OC)cc1CO |
| InChI | InChI=1S/C11H14O3/c1-4-8-5-10(13-2)11(14-3)6-9(8)7-12/h4-6,12H,1,7H2,2-3H3 |
| InChIKey | JKCVZTVHPGJXKL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |