C18H22O6Se — CID 132556150
[2-[2-(hydroxymethyl)-4,5-dimethoxyphenyl]selanyl-4,5-dimethoxyphenyl]methanol (PubChem CID 132556150) has the molecular formula C18H22O6Se and a molecular weight of 413.33 g/mol. Its IUPAC name is [2-[2-(hydroxymethyl)-4,5-dimethoxyphenyl]selanyl-4,5-dimethoxyphenyl]methanol.
| Compound Name | [2-[2-(hydroxymethyl)-4,5-dimethoxyphenyl]selanyl-4,5-dimethoxyphenyl]methanol |
|---|---|
| PubChem CID | 132556150 |
| Molecular Formula | C18H22O6Se |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | [2-[2-(hydroxymethyl)-4,5-dimethoxyphenyl]selanyl-4,5-dimethoxyphenyl]methanol |
| SMILES | COc1cc(CO)c([Se]c2cc(OC)c(OC)cc2CO)cc1OC |
| InChI | InChI=1S/C18H22O6Se/c1-21-13-5-11(9-19)17(7-15(13)23-3)25-18-8-16(24-4)14(22-2)6-12(18)10-20/h5-8,19-20H,9-10H2,1-4H3 |
| InChIKey | WVNMWFWSHIXNOX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|