C11H14F2O3 — CID 84695385
[2-(1,1-difluoroethyl)-4,5-dimethoxyphenyl]methanol (PubChem CID 84695385) has the molecular formula C11H14F2O3 and a molecular weight of 232.23 g/mol. Its IUPAC name is [2-(1,1-difluoroethyl)-4,5-dimethoxyphenyl]methanol.
| Compound Name | [2-(1,1-difluoroethyl)-4,5-dimethoxyphenyl]methanol |
|---|---|
| PubChem CID | 84695385 |
| Molecular Formula | C11H14F2O3 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | [2-(1,1-difluoroethyl)-4,5-dimethoxyphenyl]methanol |
| SMILES | COc1cc(CO)c(C(C)(F)F)cc1OC |
| InChI | InChI=1S/C11H14F2O3/c1-11(12,13)8-5-10(16-3)9(15-2)4-7(8)6-14/h4-5,14H,6H2,1-3H3 |
| InChIKey | VHBGCCPKKGBTAS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |