C10H12F3NO3 — CID 117380356
O-[[4,5-dimethoxy-2-(trifluoromethyl)phenyl]methyl]hydroxylamine (PubChem CID 117380356) has the molecular formula C10H12F3NO3 and a molecular weight of 251.20 g/mol. Its IUPAC name is O-[[4,5-dimethoxy-2-(trifluoromethyl)phenyl]methyl]hydroxylamine.
| Compound Name | O-[[4,5-dimethoxy-2-(trifluoromethyl)phenyl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 117380356 |
| Molecular Formula | C10H12F3NO3 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | O-[[4,5-dimethoxy-2-(trifluoromethyl)phenyl]methyl]hydroxylamine |
| SMILES | COc1cc(CON)c(C(F)(F)F)cc1OC |
| InChI | InChI=1S/C10H12F3NO3/c1-15-8-3-6(5-17-14)7(10(11,12)13)4-9(8)16-2/h3-4H,5,14H2,1-2H3 |
| InChIKey | MSFOKHZLXVMWQB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|