C10H15NO2 — CID 83482464
O-[(2-methoxy-4,5-dimethylphenyl)methyl]hydroxylamine (PubChem CID 83482464) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is O-[(2-methoxy-4,5-dimethylphenyl)methyl]hydroxylamine.
| Compound Name | O-[(2-methoxy-4,5-dimethylphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 83482464 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | O-[(2-methoxy-4,5-dimethylphenyl)methyl]hydroxylamine |
| SMILES | COc1cc(C)c(C)cc1CON |
| InChI | InChI=1S/C10H15NO2/c1-7-4-9(6-13-11)10(12-3)5-8(7)2/h4-5H,6,11H2,1-3H3 |
| InChIKey | JXGLMSOWOASFOB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|