C11H15ClO — CID 82469330
1-(2-chloroethyl)-2-methoxy-4,5-dimethylbenzene (PubChem CID 82469330) has the molecular formula C11H15ClO and a molecular weight of 198.69 g/mol. Its IUPAC name is 1-(2-chloroethyl)-2-methoxy-4,5-dimethylbenzene.
| Compound Name | 1-(2-chloroethyl)-2-methoxy-4,5-dimethylbenzene |
|---|---|
| PubChem CID | 82469330 |
| Molecular Formula | C11H15ClO |
| Molecular Weight | 198.69 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 1-(2-chloroethyl)-2-methoxy-4,5-dimethylbenzene |
| SMILES | COc1cc(C)c(C)cc1CCCl |
| InChI | InChI=1S/C11H15ClO/c1-8-6-10(4-5-12)11(13-3)7-9(8)2/h6-7H,4-5H2,1-3H3 |
| InChIKey | BYIKGSSNNPRXDB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.69 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|