C12H17ClO2 — CID 116926660
1-(3-chloropropyl)-2,5-dimethoxy-4-methylbenzene (PubChem CID 116926660) has the molecular formula C12H17ClO2 and a molecular weight of 228.72 g/mol. Its IUPAC name is 1-(3-chloropropyl)-2,5-dimethoxy-4-methylbenzene.
| Compound Name | 1-(3-chloropropyl)-2,5-dimethoxy-4-methylbenzene |
|---|---|
| PubChem CID | 116926660 |
| Molecular Formula | C12H17ClO2 |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 1-(3-chloropropyl)-2,5-dimethoxy-4-methylbenzene |
| SMILES | COc1cc(CCCCl)c(OC)cc1C |
| InChI | InChI=1S/C12H17ClO2/c1-9-7-12(15-3)10(5-4-6-13)8-11(9)14-2/h7-8H,4-6H2,1-3H3 |
| InChIKey | SZAICFUKKQZEBW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|