C21H28O7 — CID 134578778
[4-[2-[2-ethyl-4,5-bis(hydroxymethyl)phenoxy]ethoxy]-2-(hydroxymethyl)-5-methoxyphenyl]methanol (PubChem CID 134578778) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is [4-[2-[2-ethyl-4,5-bis(hydroxymethyl)phenoxy]ethoxy]-2-(hydroxymethyl)-5-methoxyphenyl]methanol.
| Compound Name | [4-[2-[2-ethyl-4,5-bis(hydroxymethyl)phenoxy]ethoxy]-2-(hydroxymethyl)-5-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 134578778 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [4-[2-[2-ethyl-4,5-bis(hydroxymethyl)phenoxy]ethoxy]-2-(hydroxymethyl)-5-methoxyphenyl]methanol |
| SMILES | CCc1cc(CO)c(CO)cc1OCCOc1cc(CO)c(CO)cc1OC |
| InChI | InChI=1S/C21H28O7/c1-3-14-6-15(10-22)16(11-23)7-19(14)27-4-5-28-21-9-18(13-25)17(12-24)8-20(21)26-2/h6-9,22-25H,3-5,10-13H2,1-2H3 |
| InChIKey | DYOYARHNVQGBER-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|