C12H16O3 — CID 90161973
[2,5-dimethoxy-4-[(E)-prop-1-enyl]phenyl]methanol (PubChem CID 90161973) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is [2,5-dimethoxy-4-[(E)-prop-1-enyl]phenyl]methanol.
| Compound Name | [2,5-dimethoxy-4-[(E)-prop-1-enyl]phenyl]methanol |
|---|---|
| PubChem CID | 90161973 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | [2,5-dimethoxy-4-[(E)-prop-1-enyl]phenyl]methanol |
| SMILES | C/C=C/c1cc(OC)c(CO)cc1OC |
| InChI | InChI=1S/C12H16O3/c1-4-5-9-6-12(15-3)10(8-13)7-11(9)14-2/h4-7,13H,8H2,1-3H3/b5-4+ |
| InChIKey | KXQOKOQQBZUOQJ-SNAWJCMRSA-N |
| XLogP | 2.23 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |