C11H13ClO2 — CID 46906491
1-chloro-4,5-dimethoxy-2-[(E)-prop-1-enyl]benzene (PubChem CID 46906491) has the molecular formula C11H13ClO2 and a molecular weight of 212.68 g/mol. Its IUPAC name is 1-chloro-4,5-dimethoxy-2-[(E)-prop-1-enyl]benzene.
| Compound Name | 1-chloro-4,5-dimethoxy-2-[(E)-prop-1-enyl]benzene |
|---|---|
| PubChem CID | 46906491 |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 1-chloro-4,5-dimethoxy-2-[(E)-prop-1-enyl]benzene |
| SMILES | C/C=C/c1cc(OC)c(OC)cc1Cl |
| InChI | InChI=1S/C11H13ClO2/c1-4-5-8-6-10(13-2)11(14-3)7-9(8)12/h4-7H,1-3H3/b5-4+ |
| InChIKey | ZYMZRQGYFCXBAF-SNAWJCMRSA-N |
| XLogP | 3.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |