C12H15NO3 — CID 134891354
(NE)-N-[[4,5-dimethoxy-2-[(E)-prop-1-enyl]phenyl]methylidene]hydroxylamine (PubChem CID 134891354) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is (NE)-N-[[4,5-dimethoxy-2-[(E)-prop-1-enyl]phenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[4,5-dimethoxy-2-[(E)-prop-1-enyl]phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 134891354 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (NE)-N-[[4,5-dimethoxy-2-[(E)-prop-1-enyl]phenyl]methylidene]hydroxylamine |
| SMILES | C/C=C/c1cc(OC)c(OC)cc1/C=N/O |
| InChI | InChI=1S/C12H15NO3/c1-4-5-9-6-11(15-2)12(16-3)7-10(9)8-13-14/h4-8,14H,1-3H3/b5-4+,13-8+ |
| InChIKey | JJYCSFKZNWICLY-VDXACTLNSA-N |
| XLogP | 2.55 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|