C10H11BrN2O4 — CID 19617611
2-[5-bromo-4-[(E)-hydroxyiminomethyl]-2-methoxyphenoxy]acetamide (PubChem CID 19617611) has the molecular formula C10H11BrN2O4 and a molecular weight of 303.11 g/mol. Its IUPAC name is 2-[5-bromo-4-[(E)-hydroxyiminomethyl]-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[5-bromo-4-[(E)-hydroxyiminomethyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 19617611 |
| Molecular Formula | C10H11BrN2O4 |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 2-[5-bromo-4-[(E)-hydroxyiminomethyl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(/C=N/O)c(Br)cc1OCC(N)=O |
| InChI | InChI=1S/C10H11BrN2O4/c1-16-8-2-6(4-13-15)7(11)3-9(8)17-5-10(12)14/h2-4,15H,5H2,1H3,(H2,12,14)/b13-4+ |
| InChIKey | PLEICHHWPGEUTQ-YIXHJXPBSA-N |
| XLogP | 1.13 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|