C15H12BrCl2NO3 — CID 91689795
(NZ)-N-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]hydroxylamine (PubChem CID 91689795) has the molecular formula C15H12BrCl2NO3 and a molecular weight of 405.08 g/mol. Its IUPAC name is (NZ)-N-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 91689795 |
| Molecular Formula | C15H12BrCl2NO3 |
| Molecular Weight | 405.08 g/mol |
| Exact Mass | 402.94 |
| IUPAC Name | (NZ)-N-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]hydroxylamine |
| SMILES | COc1cc(/C=N\O)c(Br)cc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H12BrCl2NO3/c1-21-14-5-10(7-19-20)11(16)6-15(14)22-8-9-2-3-12(17)13(18)4-9/h2-7,20H,8H2,1H3/b19-7- |
| InChIKey | BEGUUGVQGFAUHU-GXHLCREISA-N |
| XLogP | 5.15 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.08 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|