C8H7Cl2NO2 — CID 87389485
(NZ)-N-[(2,5-dichloro-3-methoxyphenyl)methylidene]hydroxylamine (PubChem CID 87389485) has the molecular formula C8H7Cl2NO2 and a molecular weight of 220.06 g/mol. Its IUPAC name is (NZ)-N-[(2,5-dichloro-3-methoxyphenyl)methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(2,5-dichloro-3-methoxyphenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 87389485 |
| Molecular Formula | C8H7Cl2NO2 |
| Molecular Weight | 220.06 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | (NZ)-N-[(2,5-dichloro-3-methoxyphenyl)methylidene]hydroxylamine |
| SMILES | COc1cc(Cl)cc(/C=N\O)c1Cl |
| InChI | InChI=1S/C8H7Cl2NO2/c1-13-7-3-6(9)2-5(4-11-12)8(7)10/h2-4,12H,1H3/b11-4- |
| InChIKey | QKJGVURIMTZLOK-WCIBSUBMSA-N |
| XLogP | 2.81 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.06 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|