C12H16O3 — CID 17903
1,2,4-trimethoxy-5-prop-1-enylbenzene (PubChem CID 17903) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1,2,4-trimethoxy-5-prop-1-enylbenzene.
| Compound Name | 1,2,4-trimethoxy-5-prop-1-enylbenzene |
|---|---|
| PubChem CID | 17903 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 1,2,4-trimethoxy-5-prop-1-enylbenzene |
| SMILES | CC=Cc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C12H16O3/c1-5-6-9-7-11(14-3)12(15-4)8-10(9)13-2/h5-8H,1-4H3 |
| InChIKey | RKFAZBXYICVSKP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |