C14H12F6O2 — CID 139254758
1,4-dimethoxy-2,5-bis[(Z)-3,3,3-trifluoroprop-1-enyl]benzene (PubChem CID 139254758) has the molecular formula C14H12F6O2 and a molecular weight of 326.24 g/mol. Its IUPAC name is 1,4-dimethoxy-2,5-bis[(Z)-3,3,3-trifluoroprop-1-enyl]benzene.
| Compound Name | 1,4-dimethoxy-2,5-bis[(Z)-3,3,3-trifluoroprop-1-enyl]benzene |
|---|---|
| PubChem CID | 139254758 |
| Molecular Formula | C14H12F6O2 |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 1,4-dimethoxy-2,5-bis[(Z)-3,3,3-trifluoroprop-1-enyl]benzene |
| SMILES | COc1cc(/C=C\C(F)(F)F)c(OC)cc1/C=C\C(F)(F)F |
| InChI | InChI=1S/C14H12F6O2/c1-21-11-7-10(4-6-14(18,19)20)12(22-2)8-9(11)3-5-13(15,16)17/h3-8H,1-2H3/b5-3-,6-4- |
| InChIKey | GSOVIZIBTXIEOS-GLIMQPGKSA-N |
| XLogP | 4.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |