C16H18F3NO3 — CID 171600045
N-[2-(4-buta-1,3-dienyl-2,5-dimethoxyphenyl)ethyl]-2,2,2-trifluoroacetamide (PubChem CID 171600045) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is N-[2-(4-buta-1,3-dienyl-2,5-dimethoxyphenyl)ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(4-buta-1,3-dienyl-2,5-dimethoxyphenyl)ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 171600045 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-[2-(4-buta-1,3-dienyl-2,5-dimethoxyphenyl)ethyl]-2,2,2-trifluoroacetamide |
| SMILES | C=CC=Cc1cc(OC)c(CCNC(=O)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C16H18F3NO3/c1-4-5-6-11-9-14(23-3)12(10-13(11)22-2)7-8-20-15(21)16(17,18)19/h4-6,9-10H,1,7-8H2,2-3H3,(H,20,21) |
| InChIKey | HCRPVDOFEROSCQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|