C14H16F3NO4 — CID 58838534
2,2,2-trifluoro-N-[(2R)-1-(4-formyl-2,5-dimethoxyphenyl)propan-2-yl]acetamide (PubChem CID 58838534) has the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2R)-1-(4-formyl-2,5-dimethoxyphenyl)propan-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2R)-1-(4-formyl-2,5-dimethoxyphenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 58838534 |
| Molecular Formula | C14H16F3NO4 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2R)-1-(4-formyl-2,5-dimethoxyphenyl)propan-2-yl]acetamide |
| SMILES | COc1cc(C[C@@H](C)NC(=O)C(F)(F)F)c(OC)cc1C=O |
| InChI | InChI=1S/C14H16F3NO4/c1-8(18-13(20)14(15,16)17)4-9-5-12(22-3)10(7-19)6-11(9)21-2/h5-8H,4H2,1-3H3,(H,18,20)/t8-/m1/s1 |
| InChIKey | PXMISQOUEZGRTQ-MRVPVSSYSA-N |
| XLogP | 2.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|