C14H16F5NO3 — CID 91727190
N-[1-(2,5-dimethoxyphenyl)propan-2-yl]-2,2,3,3,3-pentafluoropropanamide (PubChem CID 91727190) has the molecular formula C14H16F5NO3 and a molecular weight of 341.28 g/mol. Its IUPAC name is N-[1-(2,5-dimethoxyphenyl)propan-2-yl]-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-[1-(2,5-dimethoxyphenyl)propan-2-yl]-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 91727190 |
| Molecular Formula | C14H16F5NO3 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-[1-(2,5-dimethoxyphenyl)propan-2-yl]-2,2,3,3,3-pentafluoropropanamide |
| SMILES | COc1ccc(OC)c(CC(C)NC(=O)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F5NO3/c1-8(20-12(21)13(15,16)14(17,18)19)6-9-7-10(22-2)4-5-11(9)23-3/h4-5,7-8H,6H2,1-3H3,(H,20,21) |
| InChIKey | ORPXLXUOXRQUSP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|