C13H19N3O4 — CID 33101422
(2S)-2-(carbamoylamino)-N-[(2,5-dimethoxyphenyl)methyl]propanamide (PubChem CID 33101422) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is (2S)-2-(carbamoylamino)-N-[(2,5-dimethoxyphenyl)methyl]propanamide.
| Compound Name | (2S)-2-(carbamoylamino)-N-[(2,5-dimethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 33101422 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (2S)-2-(carbamoylamino)-N-[(2,5-dimethoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(OC)c(CNC(=O)[C@H](C)NC(N)=O)c1 |
| InChI | InChI=1S/C13H19N3O4/c1-8(16-13(14)18)12(17)15-7-9-6-10(19-2)4-5-11(9)20-3/h4-6,8H,7H2,1-3H3,(H,15,17)(H3,14,16,18)/t8-/m0/s1 |
| InChIKey | MFKPQMMRTANWND-QMMMGPOBSA-N |
| XLogP | 0.38 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |