C15H15F6NO4 — CID 91740311
[5-ethyl-4-methoxy-2-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 91740311) has the molecular formula C15H15F6NO4 and a molecular weight of 387.28 g/mol. Its IUPAC name is [5-ethyl-4-methoxy-2-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [5-ethyl-4-methoxy-2-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91740311 |
| Molecular Formula | C15H15F6NO4 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | [5-ethyl-4-methoxy-2-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | CCc1cc(OC(=O)C(F)(F)F)c(CCNC(=O)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C15H15F6NO4/c1-3-8-6-11(26-13(24)15(19,20)21)9(7-10(8)25-2)4-5-22-12(23)14(16,17)18/h6-7H,3-5H2,1-2H3,(H,22,23) |
| InChIKey | DEDBLQUFJTWCQT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|