C32H34O6 — CID 101045396
1,4-bis[(E)-2-(4-ethenyl-2,5-dimethoxyphenyl)ethenyl]-2,5-dimethoxybenzene (PubChem CID 101045396) has the molecular formula C32H34O6 and a molecular weight of 514.62 g/mol. Its IUPAC name is 1,4-bis[(E)-2-(4-ethenyl-2,5-dimethoxyphenyl)ethenyl]-2,5-dimethoxybenzene.
| Compound Name | 1,4-bis[(E)-2-(4-ethenyl-2,5-dimethoxyphenyl)ethenyl]-2,5-dimethoxybenzene |
|---|---|
| PubChem CID | 101045396 |
| Molecular Formula | C32H34O6 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 1,4-bis[(E)-2-(4-ethenyl-2,5-dimethoxyphenyl)ethenyl]-2,5-dimethoxybenzene |
| SMILES | C=Cc1cc(OC)c(/C=C/c2cc(OC)c(/C=C/c3cc(OC)c(C=C)cc3OC)cc2OC)cc1OC |
| InChI | InChI=1S/C32H34O6/c1-9-21-15-29(35-5)23(17-27(21)33-3)11-13-25-19-32(38-8)26(20-31(25)37-7)14-12-24-18-28(34-4)22(10-2)16-30(24)36-6/h9-20H,1-2H2,3-8H3/b13-11+,14-12+ |
| InChIKey | JBALFUSLEHSFSX-PHEQNACWSA-N |
| XLogP | 7.36 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|