About 5-ethenyl-6-methoxy-2-methyl-1,3-benzodioxole
5-ethenyl-6-methoxy-2-methyl-1,3-benzodioxole (PubChem CID 142470845) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is 5-ethenyl-6-methoxy-2-methyl-1,3-benzodioxole.
Molecular Properties
| Compound Name | 5-ethenyl-6-methoxy-2-methyl-1,3-benzodioxole |
| PubChem CID | 142470845 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 5-ethenyl-6-methoxy-2-methyl-1,3-benzodioxole |
| SMILES | C=Cc1cc2c(cc1OC)OC(C)O2 |
| InChI | InChI=1S/C11H12O3/c1-4-8-5-10-11(6-9(8)12-3)14-7(2)13-10/h4-7H,1H2,2-3H3 |
| InChIKey | XFNNJCLGAJQFFO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethenyl-6-methoxy-2-methyl-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-6-methoxy-2-methyl-1,3-benzodioxole?
The IUPAC name of 5-ethenyl-6-methoxy-2-methyl-1,3-benzodioxole (CID 142470845) is 5-ethenyl-6-methoxy-2-methyl-1,3-benzodioxole.
What is the SMILES notation for 5-ethenyl-6-methoxy-2-methyl-1,3-benzodioxole?
The canonical SMILES for 5-ethenyl-6-methoxy-2-methyl-1,3-benzodioxole is C=Cc1cc2c(cc1OC)OC(C)O2.
What is the InChIKey of 5-ethenyl-6-methoxy-2-methyl-1,3-benzodioxole?
The InChIKey is XFNNJCLGAJQFFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3/c1-4-8-5-10-11(6-9(8)12-3)14-7(2)13-10/h4-7H,1H2,2-3H3.
What are the key properties of 5-ethenyl-6-methoxy-2-methyl-1,3-benzodioxole?
5-ethenyl-6-methoxy-2-methyl-1,3-benzodioxole has a molecular weight of 192.21 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-6-methoxy-2-methyl-1,3-benzodioxole is sourced from PubChem (CID 142470845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).