C10H10O3 — CID 102182518
5-ethenyl-6-methoxy-1,3-benzodioxole (PubChem CID 102182518) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 5-ethenyl-6-methoxy-1,3-benzodioxole.
| Compound Name | 5-ethenyl-6-methoxy-1,3-benzodioxole |
|---|---|
| PubChem CID | 102182518 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 5-ethenyl-6-methoxy-1,3-benzodioxole |
| SMILES | C=Cc1cc2c(cc1OC)OCO2 |
| InChI | InChI=1S/C10H10O3/c1-3-7-4-9-10(13-6-12-9)5-8(7)11-2/h3-5H,1,6H2,2H3 |
| InChIKey | XHPGVMRSVZHDLW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |