C16H12O6 — CID 14614193
6-(5-formyl-2-methoxyphenoxy)-1,3-benzodioxole-5-carbaldehyde (PubChem CID 14614193) has the molecular formula C16H12O6 and a molecular weight of 300.27 g/mol. Its IUPAC name is 6-(5-formyl-2-methoxyphenoxy)-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | 6-(5-formyl-2-methoxyphenoxy)-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 14614193 |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 6-(5-formyl-2-methoxyphenoxy)-1,3-benzodioxole-5-carbaldehyde |
| SMILES | COc1ccc(C=O)cc1Oc1cc2c(cc1C=O)OCO2 |
| InChI | InChI=1S/C16H12O6/c1-19-12-3-2-10(7-17)4-16(12)22-13-6-15-14(20-9-21-15)5-11(13)8-18/h2-8H,9H2,1H3 |
| InChIKey | XYUKELGEXYOUPJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|