C9H7IO2 — CID 57443645
5-ethenyl-6-iodo-1,3-benzodioxole (PubChem CID 57443645) has the molecular formula C9H7IO2 and a molecular weight of 274.06 g/mol. Its IUPAC name is 5-ethenyl-6-iodo-1,3-benzodioxole.
| Compound Name | 5-ethenyl-6-iodo-1,3-benzodioxole |
|---|---|
| PubChem CID | 57443645 |
| Molecular Formula | C9H7IO2 |
| Molecular Weight | 274.06 g/mol |
| Exact Mass | 273.95 |
| IUPAC Name | 5-ethenyl-6-iodo-1,3-benzodioxole |
| SMILES | C=Cc1cc2c(cc1I)OCO2 |
| InChI | InChI=1S/C9H7IO2/c1-2-6-3-8-9(4-7(6)10)12-5-11-8/h2-4H,1,5H2 |
| InChIKey | SMDLHKCBUMLQQS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.06 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|