C11H12O2 — CID 89425863
4-ethenyl-6-ethyl-1,3-benzodioxole (PubChem CID 89425863) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is 4-ethenyl-6-ethyl-1,3-benzodioxole.
| Compound Name | 4-ethenyl-6-ethyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 89425863 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 4-ethenyl-6-ethyl-1,3-benzodioxole |
| SMILES | C=Cc1cc(CC)cc2c1OCO2 |
| InChI | InChI=1S/C11H12O2/c1-3-8-5-9(4-2)11-10(6-8)12-7-13-11/h4-6H,2-3,7H2,1H3 |
| InChIKey | DKQVGBOTETZKBL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |