C14H10INO2 — CID 12026563
2-[(E)-2-(6-iodo-1,3-benzodioxol-5-yl)ethenyl]pyridine (PubChem CID 12026563) has the molecular formula C14H10INO2 and a molecular weight of 351.14 g/mol. Its IUPAC name is 2-[(E)-2-(6-iodo-1,3-benzodioxol-5-yl)ethenyl]pyridine.
| Compound Name | 2-[(E)-2-(6-iodo-1,3-benzodioxol-5-yl)ethenyl]pyridine |
|---|---|
| PubChem CID | 12026563 |
| Molecular Formula | C14H10INO2 |
| Molecular Weight | 351.14 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | 2-[(E)-2-(6-iodo-1,3-benzodioxol-5-yl)ethenyl]pyridine |
| SMILES | Ic1cc2c(cc1/C=C/c1ccccn1)OCO2 |
| InChI | InChI=1S/C14H10INO2/c15-12-8-14-13(17-9-18-14)7-10(12)4-5-11-3-1-2-6-16-11/h1-8H,9H2/b5-4+ |
| InChIKey | ZYAQQFUYJQJLAP-SNAWJCMRSA-N |
| XLogP | 3.59 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.14 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|