C13H8F3N — CID 66775546
2-[2-(2,3,4-trifluorophenyl)ethenyl]pyridine (PubChem CID 66775546) has the molecular formula C13H8F3N and a molecular weight of 235.21 g/mol. Its IUPAC name is 2-[2-(2,3,4-trifluorophenyl)ethenyl]pyridine.
| Compound Name | 2-[2-(2,3,4-trifluorophenyl)ethenyl]pyridine |
|---|---|
| PubChem CID | 66775546 |
| Molecular Formula | C13H8F3N |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-[2-(2,3,4-trifluorophenyl)ethenyl]pyridine |
| SMILES | Fc1ccc(C=Cc2ccccn2)c(F)c1F |
| InChI | InChI=1S/C13H8F3N/c14-11-7-5-9(12(15)13(11)16)4-6-10-3-1-2-8-17-10/h1-8H |
| InChIKey | MHOUWRKTDKEIQG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|