About cyclobutane;2-[2-(2-fluorophenyl)ethenyl]pyridine
cyclobutane;2-[2-(2-fluorophenyl)ethenyl]pyridine (PubChem CID 175276966) has the molecular formula C17H18FN
and a molecular weight of 255.34 g/mol. Its IUPAC name is cyclobutane;2-[2-(2-fluorophenyl)ethenyl]pyridine.
Molecular Properties
| Compound Name | cyclobutane;2-[2-(2-fluorophenyl)ethenyl]pyridine |
| PubChem CID | 175276966 |
| Molecular Formula | C17H18FN |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | cyclobutane;2-[2-(2-fluorophenyl)ethenyl]pyridine |
| SMILES | C1CCC1.Fc1ccccc1C=Cc1ccccn1 |
| InChI | InChI=1S/C13H10FN.C4H8/c14-13-7-2-1-5-11(13)8-9-12-6-3-4-10-15-12;1-2-4-3-1/h1-10H;1-4H2 |
| InChIKey | FYGURIXTWQAPSK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclobutane;2-[2-(2-fluorophenyl)ethenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutane;2-[2-(2-fluorophenyl)ethenyl]pyridine?
The IUPAC name of cyclobutane;2-[2-(2-fluorophenyl)ethenyl]pyridine (CID 175276966) is cyclobutane;2-[2-(2-fluorophenyl)ethenyl]pyridine.
What is the SMILES notation for cyclobutane;2-[2-(2-fluorophenyl)ethenyl]pyridine?
The canonical SMILES for cyclobutane;2-[2-(2-fluorophenyl)ethenyl]pyridine is C1CCC1.Fc1ccccc1C=Cc1ccccn1.
What is the InChIKey of cyclobutane;2-[2-(2-fluorophenyl)ethenyl]pyridine?
The InChIKey is FYGURIXTWQAPSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10FN.C4H8/c14-13-7-2-1-5-11(13)8-9-12-6-3-4-10-15-12;1-2-4-3-1/h1-10H;1-4H2.
What are the key properties of cyclobutane;2-[2-(2-fluorophenyl)ethenyl]pyridine?
cyclobutane;2-[2-(2-fluorophenyl)ethenyl]pyridine has a molecular weight of 255.34 g/mol, XLogP of 4.95, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutane;2-[2-(2-fluorophenyl)ethenyl]pyridine is sourced from PubChem (CID 175276966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).