C23H21NO5 — CID 53497030
3-(6-ethenyl-1,3-benzodioxol-5-yl)-6,7-dimethoxy-2-prop-2-enylisoquinolin-1-one (PubChem CID 53497030) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is 3-(6-ethenyl-1,3-benzodioxol-5-yl)-6,7-dimethoxy-2-prop-2-enylisoquinolin-1-one.
| Compound Name | 3-(6-ethenyl-1,3-benzodioxol-5-yl)-6,7-dimethoxy-2-prop-2-enylisoquinolin-1-one |
|---|---|
| PubChem CID | 53497030 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 3-(6-ethenyl-1,3-benzodioxol-5-yl)-6,7-dimethoxy-2-prop-2-enylisoquinolin-1-one |
| SMILES | C=CCn1c(-c2cc3c(cc2C=C)OCO3)cc2cc(OC)c(OC)cc2c1=O |
| InChI | InChI=1S/C23H21NO5/c1-5-7-24-18(16-11-22-21(28-13-29-22)9-14(16)6-2)8-15-10-19(26-3)20(27-4)12-17(15)23(24)25/h5-6,8-12H,1-2,7,13H2,3-4H3 |
| InChIKey | SRRBBWGZRSWJSD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|