C19H15NO6 — CID 102133291
17,18-dimethoxy-5,7,11-trioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15,17,19-heptaen-14-one (PubChem CID 102133291) has the molecular formula C19H15NO6 and a molecular weight of 353.33 g/mol. Its IUPAC name is 17,18-dimethoxy-5,7,11-trioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15,17,19-heptaen-14-one.
| Compound Name | 17,18-dimethoxy-5,7,11-trioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15,17,19-heptaen-14-one |
|---|---|
| PubChem CID | 102133291 |
| Molecular Formula | C19H15NO6 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 17,18-dimethoxy-5,7,11-trioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15,17,19-heptaen-14-one |
| SMILES | COc1cc2cc3n(c(=O)c2cc1OC)COc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C19H15NO6/c1-22-15-4-10-3-13-12-6-17-18(26-9-25-17)7-14(12)24-8-20(13)19(21)11(10)5-16(15)23-2/h3-7H,8-9H2,1-2H3 |
| InChIKey | KQOPPKWCOQLATA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 68.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |