C17H14N2O5 — CID 7749326
3-(1,3-benzodioxol-5-yl)-6,7-dimethoxyquinazolin-4-one (PubChem CID 7749326) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-6,7-dimethoxyquinazolin-4-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-6,7-dimethoxyquinazolin-4-one |
|---|---|
| PubChem CID | 7749326 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-6,7-dimethoxyquinazolin-4-one |
| SMILES | COc1cc2ncn(-c3ccc4c(c3)OCO4)c(=O)c2cc1OC |
| InChI | InChI=1S/C17H14N2O5/c1-21-14-6-11-12(7-15(14)22-2)18-8-19(17(11)20)10-3-4-13-16(5-10)24-9-23-13/h3-8H,9H2,1-2H3 |
| InChIKey | YIFOIBAFNUPOQX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |