C18H17ClN2O5 — CID 171909660
3-(3-chloro-4-methoxyphenyl)-6,7,8-trimethoxyquinazolin-4-one (PubChem CID 171909660) has the molecular formula C18H17ClN2O5 and a molecular weight of 376.80 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyphenyl)-6,7,8-trimethoxyquinazolin-4-one.
| Compound Name | 3-(3-chloro-4-methoxyphenyl)-6,7,8-trimethoxyquinazolin-4-one |
|---|---|
| PubChem CID | 171909660 |
| Molecular Formula | C18H17ClN2O5 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 3-(3-chloro-4-methoxyphenyl)-6,7,8-trimethoxyquinazolin-4-one |
| SMILES | COc1ccc(-n2cnc3c(OC)c(OC)c(OC)cc3c2=O)cc1Cl |
| InChI | InChI=1S/C18H17ClN2O5/c1-23-13-6-5-10(7-12(13)19)21-9-20-15-11(18(21)22)8-14(24-2)16(25-3)17(15)26-4/h5-9H,1-4H3 |
| InChIKey | FKLOFVOTPKYPTF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |