C17H15N3O4 — CID 21004605
3-[(1,3-benzodioxol-5-ylamino)methyl]-7-methoxyquinazolin-4-one (PubChem CID 21004605) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 3-[(1,3-benzodioxol-5-ylamino)methyl]-7-methoxyquinazolin-4-one.
| Compound Name | 3-[(1,3-benzodioxol-5-ylamino)methyl]-7-methoxyquinazolin-4-one |
|---|---|
| PubChem CID | 21004605 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 3-[(1,3-benzodioxol-5-ylamino)methyl]-7-methoxyquinazolin-4-one |
| SMILES | COc1ccc2c(=O)n(CNc3ccc4c(c3)OCO4)cnc2c1 |
| InChI | InChI=1S/C17H15N3O4/c1-22-12-3-4-13-14(7-12)19-9-20(17(13)21)8-18-11-2-5-15-16(6-11)24-10-23-15/h2-7,9,18H,8,10H2,1H3 |
| InChIKey | DDUICISOOPPVLQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|