C19H18N2O2 — CID 167915221
3-(2,3-dihydro-1H-inden-5-ylmethyl)-7-methoxyquinazolin-4-one (PubChem CID 167915221) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-ylmethyl)-7-methoxyquinazolin-4-one.
| Compound Name | 3-(2,3-dihydro-1H-inden-5-ylmethyl)-7-methoxyquinazolin-4-one |
|---|---|
| PubChem CID | 167915221 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-ylmethyl)-7-methoxyquinazolin-4-one |
| SMILES | COc1ccc2c(=O)n(Cc3ccc4c(c3)CCC4)cnc2c1 |
| InChI | InChI=1S/C19H18N2O2/c1-23-16-7-8-17-18(10-16)20-12-21(19(17)22)11-13-5-6-14-3-2-4-15(14)9-13/h5-10,12H,2-4,11H2,1H3 |
| InChIKey | KVQUFISRVQLEHJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |