C18H14N4O2 — CID 139490585
7-methoxy-1-[(4-nitrosophenyl)methyl]imidazo[4,5-c]quinoline (PubChem CID 139490585) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 7-methoxy-1-[(4-nitrosophenyl)methyl]imidazo[4,5-c]quinoline.
| Compound Name | 7-methoxy-1-[(4-nitrosophenyl)methyl]imidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 139490585 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 7-methoxy-1-[(4-nitrosophenyl)methyl]imidazo[4,5-c]quinoline |
| SMILES | COc1ccc2c(c1)ncc1ncn(Cc3ccc(N=O)cc3)c12 |
| InChI | InChI=1S/C18H14N4O2/c1-24-14-6-7-15-16(8-14)19-9-17-18(15)22(11-20-17)10-12-2-4-13(21-23)5-3-12/h2-9,11H,10H2,1H3 |
| InChIKey | WUCHRWPKCFQNOU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |