C17H16N2O4S — CID 166385917
6-methoxy-3-[(4-methylsulfonylphenyl)methyl]quinazolin-4-one (PubChem CID 166385917) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is 6-methoxy-3-[(4-methylsulfonylphenyl)methyl]quinazolin-4-one.
| Compound Name | 6-methoxy-3-[(4-methylsulfonylphenyl)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 166385917 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 6-methoxy-3-[(4-methylsulfonylphenyl)methyl]quinazolin-4-one |
| SMILES | COc1ccc2ncn(Cc3ccc(S(C)(=O)=O)cc3)c(=O)c2c1 |
| InChI | InChI=1S/C17H16N2O4S/c1-23-13-5-8-16-15(9-13)17(20)19(11-18-16)10-12-3-6-14(7-4-12)24(2,21)22/h3-9,11H,10H2,1-2H3 |
| InChIKey | HAFIPJRKQNTHFM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |